C13H21ClN2 — CID 43739667
3-chloro-2-N,2-N-dimethyl-1-N-pentylbenzene-1,2-diamine (PubChem CID 43739667) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 3-chloro-2-N,2-N-dimethyl-1-N-pentylbenzene-1,2-diamine.
| Compound Name | 3-chloro-2-N,2-N-dimethyl-1-N-pentylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43739667 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-chloro-2-N,2-N-dimethyl-1-N-pentylbenzene-1,2-diamine |
| SMILES | CCCCCNc1cccc(Cl)c1N(C)C |
| InChI | InChI=1S/C13H21ClN2/c1-4-5-6-10-15-12-9-7-8-11(14)13(12)16(2)3/h7-9,15H,4-6,10H2,1-3H3 |
| InChIKey | YALKCNJLWYOXSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|