C15H12F2N4 — CID 43740277
N-[(2,5-difluorophenyl)methyl]-4-(triazol-2-yl)aniline (PubChem CID 43740277) has the molecular formula C15H12F2N4 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-(triazol-2-yl)aniline.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-(triazol-2-yl)aniline |
|---|---|
| PubChem CID | 43740277 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-(triazol-2-yl)aniline |
| SMILES | Fc1ccc(F)c(CNc2ccc(-n3nccn3)cc2)c1 |
| InChI | InChI=1S/C15H12F2N4/c16-12-1-6-15(17)11(9-12)10-18-13-2-4-14(5-3-13)21-19-7-8-20-21/h1-9,18H,10H2 |
| InChIKey | DBWMWWJBOIWKRZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |