C10H11Cl2N3S2 — CID 43740891
5,7-dichloro-N-(3-methylsulfanylpropyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 43740891) has the molecular formula C10H11Cl2N3S2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 5,7-dichloro-N-(3-methylsulfanylpropyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-(3-methylsulfanylpropyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 43740891 |
| Molecular Formula | C10H11Cl2N3S2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5,7-dichloro-N-(3-methylsulfanylpropyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | CSCCCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C10H11Cl2N3S2/c1-16-4-2-3-13-8-6(11)5-7(12)9-10(8)15-17-14-9/h5,13H,2-4H2,1H3 |
| InChIKey | ZSZXVPPXDVQOBZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|