C10H9Cl2N3S2 — CID 43740926
5,7-dichloro-N-(thiolan-3-yl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 43740926) has the molecular formula C10H9Cl2N3S2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 5,7-dichloro-N-(thiolan-3-yl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-(thiolan-3-yl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 43740926 |
| Molecular Formula | C10H9Cl2N3S2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 5,7-dichloro-N-(thiolan-3-yl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | Clc1cc(Cl)c2nsnc2c1NC1CCSC1 |
| InChI | InChI=1S/C10H9Cl2N3S2/c11-6-3-7(12)9-10(15-17-14-9)8(6)13-5-1-2-16-4-5/h3,5,13H,1-2,4H2 |
| InChIKey | JRLIQRSOOHUVPM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |