C15H21N3O2 — CID 43741600
5-[(1,2,5-trimethylpiperidin-4-yl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 43741600) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-[(1,2,5-trimethylpiperidin-4-yl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(1,2,5-trimethylpiperidin-4-yl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43741600 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-[(1,2,5-trimethylpiperidin-4-yl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC1CN(C)C(C)CC1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-9-8-18(3)10(2)6-12(9)16-11-4-5-14-13(7-11)17-15(19)20-14/h4-5,7,9-10,12,16H,6,8H2,1-3H3,(H,17,19) |
| InChIKey | ZGNVQHUJTNDICM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |