About 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol
3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol (PubChem CID 43741833) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol |
| PubChem CID | 43741833 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol |
| SMILES | Cc1ccc(NC2CCC3(CC2)OCCO3)c(C)c1O |
| InChI | InChI=1S/C16H23NO3/c1-11-3-4-14(12(2)15(11)18)17-13-5-7-16(8-6-13)19-9-10-20-16/h3-4,13,17-18H,5-10H2,1-2H3 |
| InChIKey | BZVWETYSQMZCQR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol?
The IUPAC name of 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol (CID 43741833) is 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol.
What is the SMILES notation for 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol?
The canonical SMILES for 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol is Cc1ccc(NC2CCC3(CC2)OCCO3)c(C)c1O.
What is the InChIKey of 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol?
The InChIKey is BZVWETYSQMZCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-11-3-4-14(12(2)15(11)18)17-13-5-7-16(8-6-13)19-9-10-20-16/h3-4,13,17-18H,5-10H2,1-2H3.
What are the key properties of 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol?
3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol has a molecular weight of 277.36 g/mol, XLogP of 3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2,6-dimethylphenol is sourced from PubChem (CID 43741833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).