C13H13ClFN3O2S — CID 43742045
1-chloro-3-fluoro-2-[[3-(sulfamoylamino)anilino]methyl]benzene (PubChem CID 43742045) has the molecular formula C13H13ClFN3O2S and a molecular weight of 329.78 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-[[3-(sulfamoylamino)anilino]methyl]benzene.
| Compound Name | 1-chloro-3-fluoro-2-[[3-(sulfamoylamino)anilino]methyl]benzene |
|---|---|
| PubChem CID | 43742045 |
| Molecular Formula | C13H13ClFN3O2S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-chloro-3-fluoro-2-[[3-(sulfamoylamino)anilino]methyl]benzene |
| SMILES | NS(=O)(=O)Nc1cccc(NCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C13H13ClFN3O2S/c14-12-5-2-6-13(15)11(12)8-17-9-3-1-4-10(7-9)18-21(16,19)20/h1-7,17-18H,8H2,(H2,16,19,20) |
| InChIKey | WLQUYOGKQYLILD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |