About [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol
[2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol (PubChem CID 43743338) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol |
| PubChem CID | 43743338 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol |
| SMILES | Cc1nc(C(C)Nc2ccccc2CO)cs1 |
| InChI | InChI=1S/C13H16N2OS/c1-9(13-8-17-10(2)15-13)14-12-6-4-3-5-11(12)7-16/h3-6,8-9,14,16H,7H2,1-2H3 |
| InChIKey | DCZUNIWQEKJHRF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol?
The IUPAC name of [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol (CID 43743338) is [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol.
What is the SMILES notation for [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol?
The canonical SMILES for [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol is Cc1nc(C(C)Nc2ccccc2CO)cs1.
What is the InChIKey of [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol?
The InChIKey is DCZUNIWQEKJHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-9(13-8-17-10(2)15-13)14-12-6-4-3-5-11(12)7-16/h3-6,8-9,14,16H,7H2,1-2H3.
What are the key properties of [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol?
[2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol has a molecular weight of 248.35 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]phenyl]methanol is sourced from PubChem (CID 43743338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).