C15H13F2N3 — CID 43743449
N-[1-(2,4-difluorophenyl)ethyl]-1H-indazol-6-amine (PubChem CID 43743449) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-1H-indazol-6-amine.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-1H-indazol-6-amine |
|---|---|
| PubChem CID | 43743449 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-1H-indazol-6-amine |
| SMILES | CC(Nc1ccc2cn[nH]c2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2N3/c1-9(13-5-3-11(16)6-14(13)17)19-12-4-2-10-8-18-20-15(10)7-12/h2-9,19H,1H3,(H,18,20) |
| InChIKey | DGQORWFFCZMHFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |