C12H17N3O — CID 43744613
[3-(1-cyclopropylethylamino)phenyl]urea (PubChem CID 43744613) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is [3-(1-cyclopropylethylamino)phenyl]urea.
| Compound Name | [3-(1-cyclopropylethylamino)phenyl]urea |
|---|---|
| PubChem CID | 43744613 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | [3-(1-cyclopropylethylamino)phenyl]urea |
| SMILES | CC(Nc1cccc(NC(N)=O)c1)C1CC1 |
| InChI | InChI=1S/C12H17N3O/c1-8(9-5-6-9)14-10-3-2-4-11(7-10)15-12(13)16/h2-4,7-9,14H,5-6H2,1H3,(H3,13,15,16) |
| InChIKey | MHROFWNRPHWFCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |