C14H15BrN2O2S — CID 43745169
[4-[(4-bromophenyl)methylamino]phenyl]methanesulfonamide (PubChem CID 43745169) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is [4-[(4-bromophenyl)methylamino]phenyl]methanesulfonamide.
| Compound Name | [4-[(4-bromophenyl)methylamino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 43745169 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | [4-[(4-bromophenyl)methylamino]phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(NCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-13-5-1-11(2-6-13)9-17-14-7-3-12(4-8-14)10-20(16,18)19/h1-8,17H,9-10H2,(H2,16,18,19) |
| InChIKey | RRXNSLRPAVARCX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |