C17H30N4 — CID 43746932
2,6-dimethyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]cyclohexan-1-amine (PubChem CID 43746932) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is 2,6-dimethyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 2,6-dimethyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 43746932 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2,6-dimethyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]cyclohexan-1-amine |
| SMILES | CC(NC1C(C)CCCC1C)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H30N4/c1-12-8-7-9-13(2)16(12)18-14(3)17-20-19-15-10-5-4-6-11-21(15)17/h12-14,16,18H,4-11H2,1-3H3 |
| InChIKey | VYPLSURDXBREDN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |