C17H32N4 — CID 43746945
5-methyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]heptan-3-amine (PubChem CID 43746945) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 5-methyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]heptan-3-amine.
| Compound Name | 5-methyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]heptan-3-amine |
|---|---|
| PubChem CID | 43746945 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 5-methyl-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]heptan-3-amine |
| SMILES | CCC(C)CC(CC)NC(C)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H32N4/c1-5-13(3)12-15(6-2)18-14(4)17-20-19-16-10-8-7-9-11-21(16)17/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | SOEPVCSVDRVSKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |