C12H24N2 — CID 43752121
N-pentyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 43752121) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-pentyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-pentyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 43752121 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-pentyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | CCCCCNC1CCN2CCCC12 |
| InChI | InChI=1S/C12H24N2/c1-2-3-4-8-13-11-7-10-14-9-5-6-12(11)14/h11-13H,2-10H2,1H3 |
| InChIKey | LSWLZWBKUYOYIQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|