About N'-hydroxy-3,4-dimethylbenzenecarboximidamide
N'-hydroxy-3,4-dimethylbenzenecarboximidamide (PubChem CID 43752594) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is N'-hydroxy-3,4-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-hydroxy-3,4-dimethylbenzenecarboximidamide |
| PubChem CID | 43752594 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N'-hydroxy-3,4-dimethylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(N)=N/O)cc1C |
| InChI | InChI=1S/C9H12N2O/c1-6-3-4-8(5-7(6)2)9(10)11-12/h3-5,12H,1-2H3,(H2,10,11) |
| InChIKey | XSLDELWKSXCINB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3,4-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3,4-dimethylbenzenecarboximidamide?
The IUPAC name of N'-hydroxy-3,4-dimethylbenzenecarboximidamide (CID 43752594) is N'-hydroxy-3,4-dimethylbenzenecarboximidamide.
What is the SMILES notation for N'-hydroxy-3,4-dimethylbenzenecarboximidamide?
The canonical SMILES for N'-hydroxy-3,4-dimethylbenzenecarboximidamide is Cc1ccc(/C(N)=N/O)cc1C.
What is the InChIKey of N'-hydroxy-3,4-dimethylbenzenecarboximidamide?
The InChIKey is XSLDELWKSXCINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-3-4-8(5-7(6)2)9(10)11-12/h3-5,12H,1-2H3,(H2,10,11).
What are the key properties of N'-hydroxy-3,4-dimethylbenzenecarboximidamide?
N'-hydroxy-3,4-dimethylbenzenecarboximidamide has a molecular weight of 164.21 g/mol, XLogP of 1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3,4-dimethylbenzenecarboximidamide is sourced from PubChem (CID 43752594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).