C15H27F3N2 — CID 43752659
2-N,2-N-dicyclohexyl-3,3,3-trifluoropropane-1,2-diamine (PubChem CID 43752659) has the molecular formula C15H27F3N2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-N,2-N-dicyclohexyl-3,3,3-trifluoropropane-1,2-diamine.
| Compound Name | 2-N,2-N-dicyclohexyl-3,3,3-trifluoropropane-1,2-diamine |
|---|---|
| PubChem CID | 43752659 |
| Molecular Formula | C15H27F3N2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 2-N,2-N-dicyclohexyl-3,3,3-trifluoropropane-1,2-diamine |
| SMILES | NCC(N(C1CCCCC1)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H27F3N2/c16-15(17,18)14(11-19)20(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-14H,1-11,19H2 |
| InChIKey | CQWVUVHITQWMHV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |