C8H12F3N3O2 — CID 43752797
3-(3-amino-1,1,1-trifluoropropan-2-yl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 43752797) has the molecular formula C8H12F3N3O2 and a molecular weight of 239.20 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43752797 |
| Molecular Formula | C8H12F3N3O2 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C(CN)C(F)(F)F)C1=O |
| InChI | InChI=1S/C8H12F3N3O2/c1-7(2)5(15)14(6(16)13-7)4(3-12)8(9,10)11/h4H,3,12H2,1-2H3,(H,13,16) |
| InChIKey | KPIRMLANMUMJKM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|