C9H14F3N3O2 — CID 43752804
3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-propylimidazolidine-2,4-dione (PubChem CID 43752804) has the molecular formula C9H14F3N3O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43752804 |
| Molecular Formula | C9H14F3N3O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(C(CN)C(F)(F)F)C1=O |
| InChI | InChI=1S/C9H14F3N3O2/c1-2-3-5-7(16)15(8(17)14-5)6(4-13)9(10,11)12/h5-6H,2-4,13H2,1H3,(H,14,17) |
| InChIKey | QMPNVJQEQLYOBO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|