C9H8Cl2F3NO — CID 43752865
2-(2,5-dichlorophenoxy)-3,3,3-trifluoropropan-1-amine (PubChem CID 43752865) has the molecular formula C9H8Cl2F3NO and a molecular weight of 274.07 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(2,5-dichlorophenoxy)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 43752865 |
| Molecular Formula | C9H8Cl2F3NO |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-3,3,3-trifluoropropan-1-amine |
| SMILES | NCC(Oc1cc(Cl)ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C9H8Cl2F3NO/c10-5-1-2-6(11)7(3-5)16-8(4-15)9(12,13)14/h1-3,8H,4,15H2 |
| InChIKey | QDOIUBFOSWRERR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |