About 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide (PubChem CID 43753158) has the molecular formula C10H18F3N3O
and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide |
| PubChem CID | 43753158 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CC(=O)NC1CC1)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O/c1-16(6-9(17)15-7-2-3-7)8(4-5-14)10(11,12)13/h7-8H,2-6,14H2,1H3,(H,15,17) |
| InChIKey | IGQHHYYHFWWEFG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide?
The IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide (CID 43753158) is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide.
What is the SMILES notation for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide?
The canonical SMILES for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide is CN(CC(=O)NC1CC1)C(CCN)C(F)(F)F.
What is the InChIKey of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide?
The InChIKey is IGQHHYYHFWWEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O/c1-16(6-9(17)15-7-2-3-7)8(4-5-14)10(11,12)13/h7-8H,2-6,14H2,1H3,(H,15,17).
What are the key properties of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide?
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide has a molecular weight of 253.27 g/mol, XLogP of 0.48, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-cyclopropylacetamide is sourced from PubChem (CID 43753158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).