About 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide (PubChem CID 43753159) has the molecular formula C9H18F3N3O
and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide |
| PubChem CID | 43753159 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O/c1-3-15(6-8(16)14-2)7(4-5-13)9(10,11)12/h7H,3-6,13H2,1-2H3,(H,14,16) |
| InChIKey | HLMCTQZFVIDUTQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide?
The IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide (CID 43753159) is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide.
What is the SMILES notation for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide?
The canonical SMILES for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide is CCN(CC(=O)NC)C(CCN)C(F)(F)F.
What is the InChIKey of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide?
The InChIKey is HLMCTQZFVIDUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O/c1-3-15(6-8(16)14-2)7(4-5-13)9(10,11)12/h7H,3-6,13H2,1-2H3,(H,14,16).
What are the key properties of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide?
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide has a molecular weight of 241.26 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-ethylamino]-N-methylacetamide is sourced from PubChem (CID 43753159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).