C7H10F3N3O2 — CID 43753192
3-(4-amino-1,1,1-trifluorobutan-2-yl)imidazolidine-2,4-dione (PubChem CID 43753192) has the molecular formula C7H10F3N3O2 and a molecular weight of 225.17 g/mol. Its IUPAC name is 3-(4-amino-1,1,1-trifluorobutan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 3-(4-amino-1,1,1-trifluorobutan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43753192 |
| Molecular Formula | C7H10F3N3O2 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 3-(4-amino-1,1,1-trifluorobutan-2-yl)imidazolidine-2,4-dione |
| SMILES | NCCC(N1C(=O)CNC1=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O2/c8-7(9,10)4(1-2-11)13-5(14)3-12-6(13)15/h4H,1-3,11H2,(H,12,15) |
| InChIKey | FDHWUHCUIJMTPP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|