C12H24F3NO — CID 43753333
3-(2-ethylhexoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 43753333) has the molecular formula C12H24F3NO and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(2-ethylhexoxy)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 43753333 |
| Molecular Formula | C12H24F3NO |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3-(2-ethylhexoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCCCC(CC)COC(CCN)C(F)(F)F |
| InChI | InChI=1S/C12H24F3NO/c1-3-5-6-10(4-2)9-17-11(7-8-16)12(13,14)15/h10-11H,3-9,16H2,1-2H3 |
| InChIKey | JJYWORCARRJIMQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |