C7H10F7NO — CID 43753340
4,4,4-trifluoro-3-(2,2,3,3-tetrafluoropropoxy)butan-1-amine (PubChem CID 43753340) has the molecular formula C7H10F7NO and a molecular weight of 257.15 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2,2,3,3-tetrafluoropropoxy)butan-1-amine.
| Compound Name | 4,4,4-trifluoro-3-(2,2,3,3-tetrafluoropropoxy)butan-1-amine |
|---|---|
| PubChem CID | 43753340 |
| Molecular Formula | C7H10F7NO |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4,4,4-trifluoro-3-(2,2,3,3-tetrafluoropropoxy)butan-1-amine |
| SMILES | NCCC(OCC(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F7NO/c8-5(9)6(10,11)3-16-4(1-2-15)7(12,13)14/h4-5H,1-3,15H2 |
| InChIKey | FALDCCZXGNLLMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|