C8H16N4O2 — CID 43754739
4-[(2-amino-2-oxoethyl)amino]piperidine-1-carboxamide (PubChem CID 43754739) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)amino]piperidine-1-carboxamide.
| Compound Name | 4-[(2-amino-2-oxoethyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 43754739 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)amino]piperidine-1-carboxamide |
| SMILES | NC(=O)CNC1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C8H16N4O2/c9-7(13)5-11-6-1-3-12(4-2-6)8(10)14/h6,11H,1-5H2,(H2,9,13)(H2,10,14) |
| InChIKey | QHPDWMLOLNKDEY-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |