About 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide
2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide (PubChem CID 43754755) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide.
Molecular Properties
| Compound Name | 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide |
| PubChem CID | 43754755 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide |
| SMILES | Cc1ncsc1C(C)NCC(N)=O |
| InChI | InChI=1S/C8H13N3OS/c1-5(10-3-7(9)12)8-6(2)11-4-13-8/h4-5,10H,3H2,1-2H3,(H2,9,12) |
| InChIKey | XPVXNBVGNISLPC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide?
The IUPAC name of 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide (CID 43754755) is 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide.
What is the SMILES notation for 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide?
The canonical SMILES for 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide is Cc1ncsc1C(C)NCC(N)=O.
What is the InChIKey of 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide?
The InChIKey is XPVXNBVGNISLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-5(10-3-7(9)12)8-6(2)11-4-13-8/h4-5,10H,3H2,1-2H3,(H2,9,12).
What are the key properties of 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide?
2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide has a molecular weight of 199.28 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]acetamide is sourced from PubChem (CID 43754755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).