C12H20N4S — CID 43754796
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 43754796) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43754796 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | Cc1nc2scc(C)n2c1CNCCN(C)C |
| InChI | InChI=1S/C12H20N4S/c1-9-8-17-12-14-10(2)11(16(9)12)7-13-5-6-15(3)4/h8,13H,5-7H2,1-4H3 |
| InChIKey | QKBLLIIWQLPIMM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|