C18H20ClNO — CID 43755230
5-chloro-N-[cyclopropyl-(4-methoxyphenyl)methyl]-2-methylaniline (PubChem CID 43755230) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 5-chloro-N-[cyclopropyl-(4-methoxyphenyl)methyl]-2-methylaniline.
| Compound Name | 5-chloro-N-[cyclopropyl-(4-methoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 43755230 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-chloro-N-[cyclopropyl-(4-methoxyphenyl)methyl]-2-methylaniline |
| SMILES | COc1ccc(C(Nc2cc(Cl)ccc2C)C2CC2)cc1 |
| InChI | InChI=1S/C18H20ClNO/c1-12-3-8-15(19)11-17(12)20-18(13-4-5-13)14-6-9-16(21-2)10-7-14/h3,6-11,13,18,20H,4-5H2,1-2H3 |
| InChIKey | CSDXVLGWXHAJRB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |