C12H14BrNO — CID 43755416
6-bromo-N-prop-2-enyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43755416) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 6-bromo-N-prop-2-enyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-N-prop-2-enyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43755416 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-bromo-N-prop-2-enyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | C=CCNC1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H14BrNO/c1-2-6-14-11-5-7-15-12-4-3-9(13)8-10(11)12/h2-4,8,11,14H,1,5-7H2 |
| InChIKey | QHJPYYJQGCANMM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|