C17H25NO — CID 43756033
N-cyclohexyl-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 43756033) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N-cyclohexyl-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | N-cyclohexyl-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 43756033 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-cyclohexyl-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | Cc1cccc2c1OCCCC2NC1CCCCC1 |
| InChI | InChI=1S/C17H25NO/c1-13-7-5-10-15-16(11-6-12-19-17(13)15)18-14-8-3-2-4-9-14/h5,7,10,14,16,18H,2-4,6,8-9,11-12H2,1H3 |
| InChIKey | JJJOWHRRGZJPBJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |