C13H19NO3 — CID 43756306
6-methoxy-N-(2-methoxyethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43756306) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 6-methoxy-N-(2-methoxyethyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-methoxy-N-(2-methoxyethyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43756306 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 6-methoxy-N-(2-methoxyethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COCCNC1CCOc2ccc(OC)cc21 |
| InChI | InChI=1S/C13H19NO3/c1-15-8-6-14-12-5-7-17-13-4-3-10(16-2)9-11(12)13/h3-4,9,12,14H,5-8H2,1-2H3 |
| InChIKey | DKXCOLFBDDNEOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|