C13H16N2O — CID 43756743
2-[3-[(cyclopropylmethylamino)methyl]phenoxy]acetonitrile (PubChem CID 43756743) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[3-[(cyclopropylmethylamino)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(cyclopropylmethylamino)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43756743 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[3-[(cyclopropylmethylamino)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(CNCC2CC2)c1 |
| InChI | InChI=1S/C13H16N2O/c14-6-7-16-13-3-1-2-12(8-13)10-15-9-11-4-5-11/h1-3,8,11,15H,4-5,7,9-10H2 |
| InChIKey | CGZMGUVQWCRUMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |