C16H19NS — CID 43757314
N-[(3,4-dimethylphenyl)methyl]-3-methylsulfanylaniline (PubChem CID 43757314) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-3-methylsulfanylaniline.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-3-methylsulfanylaniline |
|---|---|
| PubChem CID | 43757314 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-3-methylsulfanylaniline |
| SMILES | CSc1cccc(NCc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C16H19NS/c1-12-7-8-14(9-13(12)2)11-17-15-5-4-6-16(10-15)18-3/h4-10,17H,11H2,1-3H3 |
| InChIKey | RXOQDVUVADRKPY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |