C16H15ClN2O — CID 43757359
2-[2-[(3-chloro-4-methylanilino)methyl]phenoxy]acetonitrile (PubChem CID 43757359) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-[2-[(3-chloro-4-methylanilino)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[(3-chloro-4-methylanilino)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43757359 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[2-[(3-chloro-4-methylanilino)methyl]phenoxy]acetonitrile |
| SMILES | Cc1ccc(NCc2ccccc2OCC#N)cc1Cl |
| InChI | InChI=1S/C16H15ClN2O/c1-12-6-7-14(10-15(12)17)19-11-13-4-2-3-5-16(13)20-9-8-18/h2-7,10,19H,9,11H2,1H3 |
| InChIKey | FZJCQNSGRHKGGP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |