C15H25NO — CID 43757590
N-[1-(2-methoxyphenyl)propan-2-yl]pentan-1-amine (PubChem CID 43757590) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)propan-2-yl]pentan-1-amine.
| Compound Name | N-[1-(2-methoxyphenyl)propan-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43757590 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-[1-(2-methoxyphenyl)propan-2-yl]pentan-1-amine |
| SMILES | CCCCCNC(C)Cc1ccccc1OC |
| InChI | InChI=1S/C15H25NO/c1-4-5-8-11-16-13(2)12-14-9-6-7-10-15(14)17-3/h6-7,9-10,13,16H,4-5,8,11-12H2,1-3H3 |
| InChIKey | LQRAYLLYKUIWOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|