C15H26N4S — CID 43758883
N'-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N,N,2,2-tetramethylpropane-1,3-diamine (PubChem CID 43758883) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is N'-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N,N,2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N'-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N,N,2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43758883 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N'-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N,N,2,2-tetramethylpropane-1,3-diamine |
| SMILES | Cc1nc2scc(C)n2c1CNCC(C)(C)CN(C)C |
| InChI | InChI=1S/C15H26N4S/c1-11-8-20-14-17-12(2)13(19(11)14)7-16-9-15(3,4)10-18(5)6/h8,16H,7,9-10H2,1-6H3 |
| InChIKey | JWRJVOBGGHISRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |