C14H28F3N3 — CID 43758940
N,N,2,2-tetramethyl-N'-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propane-1,3-diamine (PubChem CID 43758940) has the molecular formula C14H28F3N3 and a molecular weight of 295.39 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43758940 |
| Molecular Formula | C14H28F3N3 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N3/c1-13(2,10-19(3)4)9-18-12-5-7-20(8-6-12)11-14(15,16)17/h12,18H,5-11H2,1-4H3 |
| InChIKey | HLMRUZQZQMTDPK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |