C16H16Cl3NO — CID 43759088
2,4,5-trichloro-N-[1-(2-methoxy-4-methylphenyl)ethyl]aniline (PubChem CID 43759088) has the molecular formula C16H16Cl3NO and a molecular weight of 344.67 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[1-(2-methoxy-4-methylphenyl)ethyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[1-(2-methoxy-4-methylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43759088 |
| Molecular Formula | C16H16Cl3NO |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2,4,5-trichloro-N-[1-(2-methoxy-4-methylphenyl)ethyl]aniline |
| SMILES | COc1cc(C)ccc1C(C)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl3NO/c1-9-4-5-11(16(6-9)21-3)10(2)20-15-8-13(18)12(17)7-14(15)19/h4-8,10,20H,1-3H3 |
| InChIKey | KSZOVJWTACQQJL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|