About N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine
N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine (PubChem CID 43759235) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine |
| PubChem CID | 43759235 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine |
| SMILES | C#CCN1CCC(NCCCN(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3/c1-3-13-21-15-10-17(11-16-21)19-12-7-14-20(2)18-8-5-4-6-9-18/h1,4-6,8-9,17,19H,7,10-16H2,2H3 |
| InChIKey | SIGRLYNWUHGABA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine (CID 43759235) is N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine is C#CCN1CCC(NCCCN(C)c2ccccc2)CC1.
What is the InChIKey of N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine?
The InChIKey is SIGRLYNWUHGABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3/c1-3-13-21-15-10-17(11-16-21)19-12-7-14-20(2)18-8-5-4-6-9-18/h1,4-6,8-9,17,19H,7,10-16H2,2H3.
What are the key properties of N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine?
N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine has a molecular weight of 285.44 g/mol, XLogP of 2.20, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-phenyl-N-(1-prop-2-ynylpiperidin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 43759235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).