C14H15Cl2N — CID 43760335
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,5-dichloroaniline (PubChem CID 43760335) has the molecular formula C14H15Cl2N and a molecular weight of 268.19 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,5-dichloroaniline.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 43760335 |
| Molecular Formula | C14H15Cl2N |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,5-dichloroaniline |
| SMILES | Clc1cc(Cl)cc(NCC2CC3C=CC2C3)c1 |
| InChI | InChI=1S/C14H15Cl2N/c15-12-5-13(16)7-14(6-12)17-8-11-4-9-1-2-10(11)3-9/h1-2,5-7,9-11,17H,3-4,8H2 |
| InChIKey | JICHOXSSNFEICH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|