C16H15F2NO2 — CID 43760727
2,2-difluoro-N-[1-(3-methylphenyl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 43760727) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2,2-difluoro-N-[1-(3-methylphenyl)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[1-(3-methylphenyl)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43760727 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2,2-difluoro-N-[1-(3-methylphenyl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1cccc(C(C)Nc2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C16H15F2NO2/c1-10-4-3-5-12(8-10)11(2)19-13-6-7-14-15(9-13)21-16(17,18)20-14/h3-9,11,19H,1-2H3 |
| InChIKey | LQZSEVLBRJUIHZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|