C17H33N3S — CID 43763215
N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 43763215) has the molecular formula C17H33N3S and a molecular weight of 311.54 g/mol. Its IUPAC name is N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43763215 |
| Molecular Formula | C17H33N3S |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC(C)c1sc(C(C)(C)C)nc1C |
| InChI | InChI=1S/C17H33N3S/c1-8-20(9-2)12-10-11-18-13(3)15-14(4)19-16(21-15)17(5,6)7/h13,18H,8-12H2,1-7H3 |
| InChIKey | HTRAAKACVIEMMS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|