C18H20ClN — CID 43764005
N-[(4-chlorophenyl)-cyclopropylmethyl]-3,5-dimethylaniline (PubChem CID 43764005) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclopropylmethyl]-3,5-dimethylaniline.
| Compound Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 43764005 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(NC(c2ccc(Cl)cc2)C2CC2)c1 |
| InChI | InChI=1S/C18H20ClN/c1-12-9-13(2)11-17(10-12)20-18(14-3-4-14)15-5-7-16(19)8-6-15/h5-11,14,18,20H,3-4H2,1-2H3 |
| InChIKey | NQNGZOATICGLID-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |