C18H27N — CID 43764536
N-(2-ethylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 43764536) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-(2-ethylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 43764536 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-(2-ethylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | CCc1ccccc1NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H27N/c1-2-14-7-5-6-10-18(14)19-17-12-11-15-8-3-4-9-16(15)13-17/h5-7,10,15-17,19H,2-4,8-9,11-13H2,1H3 |
| InChIKey | KGBWBZANWACELG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |