C13H16F2N2O — CID 43764958
1-[4-(3,5-difluoroanilino)piperidin-1-yl]ethanone (PubChem CID 43764958) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-[4-(3,5-difluoroanilino)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(3,5-difluoroanilino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 43764958 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[4-(3,5-difluoroanilino)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C13H16F2N2O/c1-9(18)17-4-2-12(3-5-17)16-13-7-10(14)6-11(15)8-13/h6-8,12,16H,2-5H2,1H3 |
| InChIKey | NJUVSZZSPBHOCU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |