C18H21F2N — CID 43765021
3,5-difluoro-N-(1-phenylhexyl)aniline (PubChem CID 43765021) has the molecular formula C18H21F2N and a molecular weight of 289.37 g/mol. Its IUPAC name is 3,5-difluoro-N-(1-phenylhexyl)aniline.
| Compound Name | 3,5-difluoro-N-(1-phenylhexyl)aniline |
|---|---|
| PubChem CID | 43765021 |
| Molecular Formula | C18H21F2N |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3,5-difluoro-N-(1-phenylhexyl)aniline |
| SMILES | CCCCCC(Nc1cc(F)cc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H21F2N/c1-2-3-5-10-18(14-8-6-4-7-9-14)21-17-12-15(19)11-16(20)13-17/h4,6-9,11-13,18,21H,2-3,5,10H2,1H3 |
| InChIKey | LORIYAAWTIENAU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|