C13H12Cl2N2O3 — CID 43767841
1-(3,4-dichlorophenyl)-N-[(5-nitrofuran-2-yl)methyl]ethanamine (PubChem CID 43767841) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[(5-nitrofuran-2-yl)methyl]ethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[(5-nitrofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43767841 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[(5-nitrofuran-2-yl)methyl]ethanamine |
| SMILES | CC(NCc1ccc([N+](=O)[O-])o1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O3/c1-8(9-2-4-11(14)12(15)6-9)16-7-10-3-5-13(20-10)17(18)19/h2-6,8,16H,7H2,1H3 |
| InChIKey | JZJUOQSQKVRSMF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|