C16H17IN4 — CID 43768195
1-(4-iodophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]ethanamine (PubChem CID 43768195) has the molecular formula C16H17IN4 and a molecular weight of 392.24 g/mol. Its IUPAC name is 1-(4-iodophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]ethanamine.
| Compound Name | 1-(4-iodophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43768195 |
| Molecular Formula | C16H17IN4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 1-(4-iodophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1nnc2ccccn12)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H17IN4/c1-12(13-5-7-14(17)8-6-13)18-10-9-16-20-19-15-4-2-3-11-21(15)16/h2-8,11-12,18H,9-10H2,1H3 |
| InChIKey | SGJOAQJZVZFYTB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|