2-(methylamino)propanoic acid

C4H9NO2 — CID 4377

IUPAC2-(methylamino)propanoic acid
SMILESCNC(C)C(=O)O
InChIInChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)
InChIKeyGDFAOVXKHJXLEI-UHFFFAOYSA-N
MW103.12 g/mol
LogP-0.32
Rot. Bonds2

About 2-(methylamino)propanoic acid

2-(methylamino)propanoic acid (PubChem CID 4377) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-(methylamino)propanoic acid.

Molecular Properties

Compound Name2-(methylamino)propanoic acid
PubChem CID4377
Molecular FormulaC4H9NO2
Molecular Weight103.12 g/mol
Exact Mass103.06
IUPAC Name2-(methylamino)propanoic acid
SMILESCNC(C)C(=O)O
InChIInChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)
InChIKeyGDFAOVXKHJXLEI-UHFFFAOYSA-N
XLogP-0.32
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500103.12
LogP ≤ 5-0.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(methylamino)propanoic acid?
The IUPAC name of 2-(methylamino)propanoic acid (CID 4377) is 2-(methylamino)propanoic acid.
What is the SMILES notation for 2-(methylamino)propanoic acid?
The canonical SMILES for 2-(methylamino)propanoic acid is CNC(C)C(=O)O.
What is the InChIKey of 2-(methylamino)propanoic acid?
The InChIKey is GDFAOVXKHJXLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7).
What are the key properties of 2-(methylamino)propanoic acid?
2-(methylamino)propanoic acid has a molecular weight of 103.12 g/mol, XLogP of -0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)propanoic acid is sourced from PubChem (CID 4377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).