C15H23N3OS — CID 43770760
3-(cyclopropylmethoxy)-N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine (PubChem CID 43770760) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | 3-(cyclopropylmethoxy)-N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43770760 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
| SMILES | Cc1nc2scc(C)n2c1CNCCCOCC1CC1 |
| InChI | InChI=1S/C15H23N3OS/c1-11-10-20-15-17-12(2)14(18(11)15)8-16-6-3-7-19-9-13-4-5-13/h10,13,16H,3-9H2,1-2H3 |
| InChIKey | PBGGNGNBSZSSSR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|